Improved synthesis of tetrakis(porphyrin) molecular cleft via palladium-mediated cross-coupling between a bis(porphyrin) boronic ester and bis(iodophenyl)butadiyne

Abstract

Tetrakis(porphyrin) molecular cleft was prepared by Suzuki-Miyaura cross coupling between a bis(porphyrin) boronate ester and 1,4-bis(4-iodophenyl)-1,3-butadiyne. The overall yield of the Tetrakis(porphyrin) was found to be more than doubled compared to that reported previously. The successful preparation of tetrakis(porphyrin) was characterized by a combination of nuclear magnetic resonance (NMR) spectroscopy and high resolution mass spectrometry (HRMS). Furthermore, HRMS evidenced the formation of supramolecular polymeric species driven by bis(porphyrin)-bis(porphyrin) dimerization in the gas phase.