Structure of bis(salicylato)-di(nicotinamide)copper(II)

Abstract

Abstract Dark violet crystals of Cu(C6H4OHCOO)2(NC5H4CONH2)2 crystallize in the orthorhombic system, group Pbca (No. 61), with unit cell parameters a = 14.625(7), b = 9.572(5), c = 18.671(9) Å, V = 2613.76 Å3, Z = 4. The structure was solved using direct methods, and refined by the least-squares method. Final R = 0.055 for 1361 independent reflexions. The coordination polyhedron around Cu(II) is a highly deformed octahedron, formed by four carboxylate oxygen atoms from two salicylate ligands [Cu–O bond lengths are 1.935(6) (2 ×) and 2.609(6) Å (2 ×)] and two nitrogen atoms from two nicotinamides [Cu–N bond lengths: 1.994(7) Å (2 ×)]. Molecular structural units in the crystal are interlinked by hydrogen bonds of nitrogen and oxygen atoms of nicotinamides.