Subject
Electrical and Electronic Engineering,Atomic and Molecular Physics, and Optics,Electronic, Optical and Magnetic Materials,Inorganic Chemistry,Organic Chemistry,Physical and Theoretical Chemistry,Spectroscopy
Reference54 articles.
1. High‐temperature photoluminescence of CsPbX3 (X=Cl, Br, I) nanocrystals;Diroll;Adv. Funct. Mater.,2017
2. In situ embedding synthesis of highly stable CsPbBr3/CsPb2Br5@PbBr(OH) nano/microspheres through water assisted strategy;Du;Adv. Funct. Mater.,2021
3. Nanocrystals of cesium lead halide perovskites (CsPbX3, X=Cl, Br, and I): novel optoelectronic materials showing bright emission with wide color gamut;Protesescu;Nano Lett.,2015
4. One-pot synthesis of highly stable CsPbBr3@SiO2 core-shell nanoparticles;Zhong;ACS Nano,2018
5. Ultrastable and highly efficient green-emitting perovskite quantum dot composites for Mini-LED displays or backlights;Xuan;Nano Energy,2022