1. Stereochemistry and reaction rates of anionopentaamine complexes of cobalt(III) and chromium(III)
2. MeNH2 = CH3NH2, EtNH2 = CH3CH2NH2, nPrNH2 = CH3(CH2)2NH2, nBuNH2 = CH3(CH2)3NH2, iBuNH2 = (CH3)2CHCH2NH2, nPentNH2 = CH3(CH2)4NH2, nHexNH2 = CH3(CH2)5NH2, BzNH2 = benzylamine, cyclohexNH2 = cyclohexylamine, cyclohexCH2NH2 = cyclohexylmethylamine, py = pyridine, 4-nPrpy = 4-npropylpyridine, 4-Bzpy = 4-benzylpyridine, 3,5-Me2py = 3,5-dimethyl pyridine, 3-Et, 4-Mepy = 3-ethyl-4-methylpyridine, en = NH2(CH2)2NH2, tmd = NH2(CH2)3NH2, pn = NH2CH(CH3)CH2NH2, Metmd = CH3NH(CH2)3NH2, dien = NH2 (CH2)2NH(CH2)2NH2, trien = NH2(CH2)2 NH(CH2)2NH(CH2)NH2, tetren = NH2(CH2)2NH(CH2)2NH(CH2)2NH(CH2)2NH2, Na[(+)AsOT] = sodium arsenyl-(+)-tartrate, DMF = dimethylformamide.
3. The synthesis of μ-peroxo and chloropentaminecobalt (III) complexes with polyamine ligands
4. Crystal and molecular structure of racemic .alpha.-(amminechlorotriethylenetetramine)cobalt(III) nitrate